![[ICO]](/icons/blank.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| cover.jpg | 2023-11-08 01:42 | 69K | |
| Paul (Skit) - muiscp..> | 2023-11-08 01:43 | 685K | |
| Ken Kaniff (Skit) - ..> | 2023-11-08 01:43 | 6.8M | |
| Public Service Annou..> | 2023-11-08 01:43 | 1.9M | |
| Amityville (Album Ve..> | 2023-11-08 01:43 | 28M | |
| Bitch Please II - mu..> | 2023-11-08 01:43 | 30M | |
| Steve Berman - muisc..> | 2023-11-08 01:43 | 5.1M | |
| Drug Ballad - muiscp..> | 2023-11-08 01:44 | 32M | |
| Kill You - muiscpars..> | 2023-11-08 01:44 | 23M | |
| Criminal - muiscpars..> | 2023-11-08 01:44 | 31M | |
| I'm Back - muiscpars..> | 2023-11-08 01:45 | 29M | |
| Remember Me - muiscp..> | 2023-11-08 01:45 | 24M | |
| Marshall Mathers - m..> | 2023-11-08 01:45 | 33M | |
| The Real Slim Shady ..> | 2023-11-08 01:45 | 30M | |
| Who Knew - muiscpars..> | 2023-11-08 01:45 | 22M | |
| Kim - muiscpars.flac | 2023-11-08 01:46 | 44M | |
| Stan - muiscpars.flac | 2023-11-08 01:46 | 45M | |
| Under The Influence ..> | 2023-11-08 01:46 | 32M | |
| The Way I Am - muisc..> | 2023-11-08 01:46 | 32M | |