![[ICO]](/icons/blank.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Sofia - Ba Man Bash ..> | 2023-11-08 11:34 | 3.1M | |
| Sofia - Ba Man Bash ..> | 2023-11-08 11:34 | 7.6M | |
| Sofia - Chi Shod 128..> | 2023-11-08 11:34 | 3.1M | |
| Sofia - Chi Shod 320..> | 2023-11-08 11:35 | 7.2M | |
| Sofia - Ki Joz To 12..> | 2023-11-08 11:34 | 3.5M | |
| Sofia - Ki Joz To 32..> | 2023-11-08 11:35 | 8.4M | |
| Sofia - Yeki Hast 12..> | 2023-11-08 11:34 | 2.6M | |
| Sofia - Yeki Hast 32..> | 2023-11-08 11:35 | 6.3M | |